* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC274070 |
English Synonyms: | BCH-RESEARCH BC274070 |
MDL Number.: | MFCD12727255 |
H bond acceptor: | 9 |
H bond donor: | 3 |
Smile: | CCn1cc(c(n1)N)S(=O)(=O)NCCS(=O)(=O)N |
InChi: | InChI=1S/C7H15N5O4S2/c1-2-12-5-6(7(8)11-12)18(15,16)10-3-4-17(9,13)14/h5,10H,2-4H2,1H3,(H2,8,11)(H2,9,13,14) |
InChiKey: | InChIKey=CEBVRTVDVACVTQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.