* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC274073 |
English Synonyms: | BCH-RESEARCH BC274073 |
MDL Number.: | MFCD12727257 |
H bond acceptor: | 8 |
H bond donor: | 3 |
Smile: | CCn1cc(c(n1)N)S(=O)(=O)NCCNC(=O)C |
InChi: | InChI=1S/C9H17N5O3S/c1-3-14-6-8(9(10)13-14)18(16,17)12-5-4-11-7(2)15/h6,12H,3-5H2,1-2H3,(H2,10,13)(H,11,15) |
InChiKey: | InChIKey=XNCLFYRFBNITTG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.