* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC274112 |
| English Synonyms: | BCH-RESEARCH BC274112 |
| MDL Number.: | MFCD12727296 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | CCn1cc(c(n1)N)S(=O)(=O)N(CCO)C(C)C |
| InChi: | InChI=1S/C10H20N4O3S/c1-4-13-7-9(10(11)12-13)18(16,17)14(5-6-15)8(2)3/h7-8,15H,4-6H2,1-3H3,(H2,11,12) |
| InChiKey: | InChIKey=ZBMURGXGSQAUFN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.