* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC274519 |
English Synonyms: | BCH-RESEARCH BC274519 |
MDL Number.: | MFCD12727570 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | C1CC(CCC1C(=O)O)NC(=O)C2CCC(=O)N2 |
InChi: | InChI=1S/C12H18N2O4/c15-10-6-5-9(14-10)11(16)13-8-3-1-7(2-4-8)12(17)18/h7-9H,1-6H2,(H,13,16)(H,14,15)(H,17,18) |
InChiKey: | InChIKey=UHLYUKBLLFLOLO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.