* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC274557 |
| English Synonyms: | BCH-RESEARCH BC274557 |
| MDL Number.: | MFCD12727593 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | Cc1c(snn1)C(=O)NC2CCC(CC2)C(=O)O |
| InChi: | InChI=1S/C11H15N3O3S/c1-6-9(18-14-13-6)10(15)12-8-4-2-7(3-5-8)11(16)17/h7-8H,2-5H2,1H3,(H,12,15)(H,16,17) |
| InChiKey: | InChIKey=VMVWXEYWUQMJAG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.