* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC274558 |
English Synonyms: | BCH-RESEARCH BC274558 |
MDL Number.: | MFCD12727594 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | Cc1ccc(n1C)C(=O)NC2CCC(CC2)C(=O)O |
InChi: | InChI=1S/C14H20N2O3/c1-9-3-8-12(16(9)2)13(17)15-11-6-4-10(5-7-11)14(18)19/h3,8,10-11H,4-7H2,1-2H3,(H,15,17)(H,18,19) |
InChiKey: | InChIKey=IGVJWAOUPDWBHN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.