* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC274951 |
English Synonyms: | BCH-RESEARCH BC274951 |
MDL Number.: | MFCD12727901 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | c1c(csc1[N+](=O)[O-])C(=O)N(CC2CC2)CC(=O)O |
InChi: | InChI=1S/C11H12N2O5S/c14-10(15)5-12(4-7-1-2-7)11(16)8-3-9(13(17)18)19-6-8/h3,6-7H,1-2,4-5H2,(H,14,15) |
InChiKey: | InChIKey=LPAVFOGBAUGOFM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.