* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BENZYL((BICYCLO[4.2.0]OCTA-1,3,5-TRIEN-7-YLMETHYL))AMINE |
English Synonyms: | BENZYL((BICYCLO[4.2.0]OCTA-1,3,5-TRIEN-7-YLMETHYL))AMINE |
MDL Number.: | MFCD12728419 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)CNCC2Cc3c2cccc3 |
InChi: | InChI=1S/C16H17N/c1-2-6-13(7-3-1)11-17-12-15-10-14-8-4-5-9-16(14)15/h1-9,15,17H,10-12H2 |
InChiKey: | InChIKey=RZNSJPYLUFOZDN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.