* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC277235 |
| English Synonyms: | BCH-RESEARCH BC277235 |
| MDL Number.: | MFCD12729584 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | c1c(cc(c(c1F)S(=O)(=O)NCCC(=O)N)Br)F |
| InChi: | InChI=1S/C9H9BrF2N2O3S/c10-6-3-5(11)4-7(12)9(6)18(16,17)14-2-1-8(13)15/h3-4,14H,1-2H2,(H2,13,15) |
| InChiKey: | InChIKey=KUDJGKPLKHALNK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.