* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC277245 |
English Synonyms: | BCH-RESEARCH BC277245 |
MDL Number.: | MFCD12729589 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1cc(c(cc1Br)Br)S(=O)(=O)NCCS(=O)(=O)N |
InChi: | InChI=1S/C8H10Br2N2O4S2/c9-6-1-2-8(7(10)5-6)18(15,16)12-3-4-17(11,13)14/h1-2,5,12H,3-4H2,(H2,11,13,14) |
InChiKey: | InChIKey=BXQQIBSIKKARJN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.