* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC312067 |
English Synonyms: | BCH-RESEARCH BC312067 |
MDL Number.: | MFCD12730430 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CC(C)N(CC(=O)O)C(=O)c1cc(ccc1OC)Cl |
InChi: | InChI=1S/C13H16ClNO4/c1-8(2)15(7-12(16)17)13(18)10-6-9(14)4-5-11(10)19-3/h4-6,8H,7H2,1-3H3,(H,16,17) |
InChiKey: | InChIKey=IDYFKPAWSDNNAR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.