* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC312098 |
English Synonyms: | BCH-RESEARCH BC312098 |
MDL Number.: | MFCD12730444 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CC(C)N(CC(=O)O)C(=O)c1ccc2c(c1)nc[nH]2 |
InChi: | InChI=1S/C13H15N3O3/c1-8(2)16(6-12(17)18)13(19)9-3-4-10-11(5-9)15-7-14-10/h3-5,7-8H,6H2,1-2H3,(H,14,15)(H,17,18) |
InChiKey: | InChIKey=MDJZXPJETPFUGE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.