* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC278362 |
| English Synonyms: | BCH-RESEARCH BC278362 |
| MDL Number.: | MFCD12730558 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CC(C)N(CCC(=O)O)C(=O)c1cc(ccc1Br)F |
| InChi: | InChI=1S/C13H15BrFNO3/c1-8(2)16(6-5-12(17)18)13(19)10-7-9(15)3-4-11(10)14/h3-4,7-8H,5-6H2,1-2H3,(H,17,18) |
| InChiKey: | InChIKey=XNXFFQRPIXTKLA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.