* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC278755 |
| English Synonyms: | BCH-RESEARCH BC278755 |
| MDL Number.: | MFCD12730798 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CC(C)(C)N(CCC(=O)O)C(=O)C1CSC(=O)N1 |
| InChi: | InChI=1S/C11H18N2O4S/c1-11(2,3)13(5-4-8(14)15)9(16)7-6-18-10(17)12-7/h7H,4-6H2,1-3H3,(H,12,17)(H,14,15) |
| InChiKey: | InChIKey=XFMQOHCEYQESNG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.