* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC278791 |
English Synonyms: | BCH-RESEARCH BC278791 |
MDL Number.: | MFCD12730819 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCn1cccc1C(=O)N(CCC(=O)O)C(C)(C)C |
InChi: | InChI=1S/C14H22N2O3/c1-5-15-9-6-7-11(15)13(19)16(14(2,3)4)10-8-12(17)18/h6-7,9H,5,8,10H2,1-4H3,(H,17,18) |
InChiKey: | InChIKey=OMPQUFXSVONSDS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.