* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC278796 |
English Synonyms: | BCH-RESEARCH BC278796 |
MDL Number.: | MFCD12730821 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cc(cc(c1)Cl)N(CC(=O)O)C(=O)C2CCCC2 |
InChi: | InChI=1S/C14H16ClNO3/c15-11-6-3-7-12(8-11)16(9-13(17)18)14(19)10-4-1-2-5-10/h3,6-8,10H,1-2,4-5,9H2,(H,17,18) |
InChiKey: | InChIKey=RQWAPIVYSZRNCG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.