* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC278883 |
English Synonyms: | BCH-RESEARCH BC278883 |
MDL Number.: | MFCD12730868 |
H bond acceptor: | 6 |
H bond donor: | 4 |
Smile: | c1cc(c(cc1C(=O)O)O)NC(=O)c2cc(c[nH]2)Br |
InChi: | InChI=1S/C12H9BrN2O4/c13-7-4-9(14-5-7)11(17)15-8-2-1-6(12(18)19)3-10(8)16/h1-5,14,16H,(H,15,17)(H,18,19) |
InChiKey: | InChIKey=KDZWWJLKGMPNDZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.