* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC279473 |
English Synonyms: | BCH-RESEARCH BC279473 |
MDL Number.: | MFCD12731233 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CC(C)N(CCCC(=O)O)S(=O)(=O)c1ccn(c1)C |
InChi: | InChI=1S/C12H20N2O4S/c1-10(2)14(7-4-5-12(15)16)19(17,18)11-6-8-13(3)9-11/h6,8-10H,4-5,7H2,1-3H3,(H,15,16) |
InChiKey: | InChIKey=ZUCYQOJMORWHDU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.