* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC279565 |
| English Synonyms: | BCH-RESEARCH BC279565 |
| MDL Number.: | MFCD12731314 |
| H bond acceptor: | 9 |
| H bond donor: | 3 |
| Smile: | Cn1cc(cn1)S(=O)(=O)NC(CCC(=O)O)C(=O)O |
| InChi: | InChI=1S/C9H13N3O6S/c1-12-5-6(4-10-12)19(17,18)11-7(9(15)16)2-3-8(13)14/h4-5,7,11H,2-3H2,1H3,(H,13,14)(H,15,16) |
| InChiKey: | InChIKey=WXVSYHVUWCEBAB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.