* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC279615 |
English Synonyms: | BCH-RESEARCH BC279615 |
MDL Number.: | MFCD12731343 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | CC(C)(C)N(CCC(=O)O)S(=O)(=O)c1cnn(c1)C |
InChi: | InChI=1S/C11H19N3O4S/c1-11(2,3)14(6-5-10(15)16)19(17,18)9-7-12-13(4)8-9/h7-8H,5-6H2,1-4H3,(H,15,16) |
InChiKey: | InChIKey=AARTXYYAQLKWCV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.