* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC283856 |
| English Synonyms: | BCH-RESEARCH BC283856 |
| MDL Number.: | MFCD12734689 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | c1cc(c(cc1C(=O)N)NC(=O)C2(CCCC2)N)Cl |
| InChi: | InChI=1S/C13H16ClN3O2/c14-9-4-3-8(11(15)18)7-10(9)17-12(19)13(16)5-1-2-6-13/h3-4,7H,1-2,5-6,16H2,(H2,15,18)(H,17,19) |
| InChiKey: | InChIKey=FGVKDWHVEHUYEW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.