* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC283892 |
English Synonyms: | BCH-RESEARCH BC283892 |
MDL Number.: | MFCD12734726 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | Cc1cc(ccc1NC(=O)C2(CCCC2)N)C(=O)N |
InChi: | InChI=1S/C14H19N3O2/c1-9-8-10(12(15)18)4-5-11(9)17-13(19)14(16)6-2-3-7-14/h4-5,8H,2-3,6-7,16H2,1H3,(H2,15,18)(H,17,19) |
InChiKey: | InChIKey=DHWVAOKSANGPIM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.