* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC1331820 |
English Synonyms: | BCH-RESEARCH BC1331820 |
MDL Number.: | MFCD12741536 |
H bond acceptor: | 8 |
H bond donor: | 4 |
Smile: | c1cc(ccc1CNC(=O)C/C(=N/O)/N)S(=O)(=O)N |
InChi: | InChI=1S/C10H14N4O4S/c11-9(14-16)5-10(15)13-6-7-1-3-8(4-2-7)19(12,17)18/h1-4,16H,5-6H2,(H2,11,14)(H,13,15)(H2,12,17,18) |
InChiKey: | InChIKey=IGFUFWQROYXCBF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.