* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC231802 |
English Synonyms: | BCH-RESEARCH BC231802 |
MDL Number.: | MFCD12744686 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | CCc1ccc(cc1N)S(=O)(=O)NCCS(=O)(=O)N |
InChi: | InChI=1S/C10H17N3O4S2/c1-2-8-3-4-9(7-10(8)11)19(16,17)13-5-6-18(12,14)15/h3-4,7,13H,2,5-6,11H2,1H3,(H2,12,14,15) |
InChiKey: | InChIKey=GZKZJAGTSFNNCZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.