* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC231815 |
English Synonyms: | BCH-RESEARCH BC231815 |
MDL Number.: | MFCD12744691 |
H bond acceptor: | 8 |
H bond donor: | 3 |
Smile: | COc1ccc(cc1N)S(=O)(=O)NCCS(=O)(=O)N |
InChi: | InChI=1S/C9H15N3O5S2/c1-17-9-3-2-7(6-8(9)10)19(15,16)12-4-5-18(11,13)14/h2-3,6,12H,4-5,10H2,1H3,(H2,11,13,14) |
InChiKey: | InChIKey=BYSUCGZGGOHNKB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.