* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC231934 |
English Synonyms: | BCH-RESEARCH BC231934 |
MDL Number.: | MFCD12744701 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | CC(c1ccc(cc1)S(=O)(=O)NCCS(=O)(=O)N)O |
InChi: | InChI=1S/C10H16N2O5S2/c1-8(13)9-2-4-10(5-3-9)19(16,17)12-6-7-18(11,14)15/h2-5,8,12-13H,6-7H2,1H3,(H2,11,14,15) |
InChiKey: | InChIKey=VZJNXRCUPTYHMH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.