* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC263428 |
| English Synonyms: | BCH-RESEARCH BC263428 |
| MDL Number.: | MFCD12748586 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | COc1ccc(cc1S(=O)(=O)NCCS(=O)(=O)N)Br |
| InChi: | InChI=1S/C9H13BrN2O5S2/c1-17-8-3-2-7(10)6-9(8)19(15,16)12-4-5-18(11,13)14/h2-3,6,12H,4-5H2,1H3,(H2,11,13,14) |
| InChiKey: | InChIKey=HIBPSELQFMPMOX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.