* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC278643 |
English Synonyms: | BCH-RESEARCH BC278643 |
MDL Number.: | MFCD12749495 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | Cn1cccc1C(=O)N(CC(=O)O)C2CCCC2 |
InChi: | InChI=1S/C13H18N2O3/c1-14-8-4-7-11(14)13(18)15(9-12(16)17)10-5-2-3-6-10/h4,7-8,10H,2-3,5-6,9H2,1H3,(H,16,17) |
InChiKey: | InChIKey=FJLOKJZVLDLFLM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.