* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | TERT-BUTYL(3-(4H,5H,6H,7H-THIENO[3,2-C]PYRIDIN-5-YL)PROPYL)AMINE |
| English Synonyms: | TERT-BUTYL(3-(4H,5H,6H,7H-THIENO[3,2-C]PYRIDIN-5-YL)PROPYL)AMINE |
| MDL Number.: | MFCD12751734 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)NCCCN1CCc2c(ccs2)C1 |
| InChi: | InChI=1S/C14H24N2S/c1-14(2,3)15-7-4-8-16-9-5-13-12(11-16)6-10-17-13/h6,10,15H,4-5,7-9,11H2,1-3H3 |
| InChiKey: | InChIKey=WMCSWOMGGPSVQQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.