* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9,10-DIBROMO DECANOL |
English Synonyms: | 9,10-DIBROMO DECANOL ; 9,10-DIBROMODECAN-1-OL |
MDL Number.: | MFCD12755154 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | C(CCCCO)CCCC(CBr)Br |
InChi: | InChI=1S/C10H20Br2O/c11-9-10(12)7-5-3-1-2-4-6-8-13/h10,13H,1-9H2 |
InChiKey: | InChIKey=BJSFINRBAUPBKA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.