* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DESFERRITHIOCIN |
| CAS: | 105635-69-6 |
| English Synonyms: | DESFERRITHIOCIN |
| MDL Number.: | MFCD12756410 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | C[C@@]1(CSC(=N1)c2c(cccn2)O)C(=O)[O-].[Na+] |
| InChi: | InChI=1S/C10H10N2O3S.Na/c1-10(9(14)15)5-16-8(12-10)7-6(13)3-2-4-11-7;/h2-4,13H,5H2,1H3,(H,14,15);/q;+1/p-1/t10-;/m1./s1 |
| InChiKey: | InChIKey=UGJSEILLHZKUBG-HNCPQSOCSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.