* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9-ETHYL-3,6-DIMETHYLCARBAZOLE |
| CAS: | 51545-42-7 |
| English Synonyms: | 9-ETHYL-3,6-DIMETHYLCARBAZOLE |
| MDL Number.: | MFCD12756510 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | CCn1c2ccc(cc2c3c1ccc(c3)C)C |
| InChi: | InChI=1S/C16H17N/c1-4-17-15-7-5-11(2)9-13(15)14-10-12(3)6-8-16(14)17/h5-10H,4H2,1-3H3 |
| InChiKey: | InChIKey=CPBVTWVQIIIDPH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.