* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC882964 |
| English Synonyms: | BCH-RESEARCH BC882964 |
| MDL Number.: | MFCD12783919 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | c1ccc(cc1)S(=O)(=O)NCCS(=O)(=O)N |
| InChi: | InChI=1S/C8H12N2O4S2/c9-15(11,12)7-6-10-16(13,14)8-4-2-1-3-5-8/h1-5,10H,6-7H2,(H2,9,11,12) |
| InChiKey: | InChIKey=NYZSQLLPTYBTPI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.