* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC664282 |
English Synonyms: | BCH-RESEARCH BC664282 |
MDL Number.: | MFCD12792039 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC(C)(C#N)NS(=O)(=O)c1ccc(cc1)Br |
InChi: | InChI=1S/C10H11BrN2O2S/c1-10(2,7-12)13-16(14,15)9-5-3-8(11)4-6-9/h3-6,13H,1-2H3 |
InChiKey: | InChIKey=XGNJNFVMLVZEHQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.