* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC664383 |
English Synonyms: | BCH-RESEARCH BC664383 |
MDL Number.: | MFCD12793242 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC(C#N)NS(=O)(=O)c1ccccc1Br |
InChi: | InChI=1S/C9H9BrN2O2S/c1-7(6-11)12-15(13,14)9-5-3-2-4-8(9)10/h2-5,7,12H,1H3 |
InChiKey: | InChIKey=BOFIWPBOOQGNCD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.