* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC664420 |
| English Synonyms: | BCH-RESEARCH BC664420 |
| MDL Number.: | MFCD12793615 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | CC1CCC(CC1)(C#N)N2CCCS2(=O)=O |
| InChi: | InChI=1S/C11H18N2O2S/c1-10-3-5-11(9-12,6-4-10)13-7-2-8-16(13,14)15/h10H,2-8H2,1H3 |
| InChiKey: | InChIKey=MHVIJBXFXFESDL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.