* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BUTYL (2R)-2-AMINO-2-PHENYLACETATE |
English Synonyms: | BUTYL (2R)-2-AMINO-2-PHENYLACETATE |
MDL Number.: | MFCD12796125 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCCCOC(=O)[C@@H](c1ccccc1)N |
InChi: | InChI=1S/C12H17NO2/c1-2-3-9-15-12(14)11(13)10-7-5-4-6-8-10/h4-8,11H,2-3,9,13H2,1H3/t11-/m1/s1 |
InChiKey: | InChIKey=AESPFTAPAXAIPF-LLVKDONJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.