* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC662879 |
English Synonyms: | BCH-RESEARCH BC662879 |
MDL Number.: | MFCD12798663 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1cc(ccc1C(=O)NCCCC(=O)N)Br |
InChi: | InChI=1S/C11H13BrN2O2/c12-9-5-3-8(4-6-9)11(16)14-7-1-2-10(13)15/h3-6H,1-2,7H2,(H2,13,15)(H,14,16) |
InChiKey: | InChIKey=MOKBPJFNTSHRIW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.