* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9-METHYL-2,3,4,5-TETRAHYDRO-1-BENZOTHIEPIN-5-ONE |
| English Synonyms: | 9-METHYL-2,3,4,5-TETRAHYDRO-1-BENZOTHIEPIN-5-ONE |
| MDL Number.: | MFCD12799814 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | Cc1cccc2c1SCCCC2=O |
| InChi: | InChI=1S/C11H12OS/c1-8-4-2-5-9-10(12)6-3-7-13-11(8)9/h2,4-5H,3,6-7H2,1H3 |
| InChiKey: | InChIKey=QRNVKKKVOYWJEP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.