* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9-METHYL-6-(PROPAN-2-YL)-2,3,4,5-TETRAHYDRO-1-BENZOXEPIN-5-AMINE |
| English Synonyms: | 9-METHYL-6-(PROPAN-2-YL)-2,3,4,5-TETRAHYDRO-1-BENZOXEPIN-5-AMINE |
| MDL Number.: | MFCD12822830 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | Cc1ccc(c2c1OCCCC2N)C(C)C |
| InChi: | InChI=1S/C14H21NO/c1-9(2)11-7-6-10(3)14-13(11)12(15)5-4-8-16-14/h6-7,9,12H,4-5,8,15H2,1-3H3 |
| InChiKey: | InChIKey=FOCYCVKCDOGQPN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.