* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | TCS 2312 DIHYDROCHLORIDE |
| CAS: | 838823-32-8 |
| English Synonyms: | TCS 2312 DIHYDROCHLORIDE |
| MDL Number.: | MFCD12828746 |
| H bond acceptor: | 6 |
| H bond donor: | 5 |
| Smile: | c1cc(ccc1CNC2CC2)Nc3cc([nH]n3)c4ccc(cc4)c5ccc(cc5O)O.Cl.Cl |
| InChi: | InChI=1S/C25H24N4O2.2ClH/c30-21-11-12-22(24(31)13-21)17-3-5-18(6-4-17)23-14-25(29-28-23)27-20-7-1-16(2-8-20)15-26-19-9-10-19;;/h1-8,11-14,19,26,30-31H,9-10,15H2,(H2,27,28,29);2*1H |
| InChiKey: | InChIKey=WMYWZZGPMOCTBG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.