* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PD 168568 DIHYDROCHLORIDE |
| CAS: | 210688-56-5 |
| English Synonyms: | PD 168568 DIHYDROCHLORIDE |
| MDL Number.: | MFCD12828776 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | Cc1ccc(cc1C)N2CCN(CC2)CCC3c4ccccc4C(=O)N3.Cl.Cl |
| InChi: | InChI=1S/C22H27N3O.2ClH/c1-16-7-8-18(15-17(16)2)25-13-11-24(12-14-25)10-9-21-19-5-3-4-6-20(19)22(26)23-21;;/h3-8,15,21H,9-14H2,1-2H3,(H,23,26);2*1H |
| InChiKey: | InChIKey=RMNWLEGGYCVHFD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.