* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | XANOMELINE OXALATE |
| CAS: | 141064-23-5 |
| English Synonyms: | XANOMELINE OXALATE |
| MDL Number.: | MFCD12828778 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | CCCCCCOc1c(nsn1)C2=CCCN(C2)C.C(=O)(C(=O)O)O |
| InChi: | InChI=1S/C14H23N3OS.C2H2O4/c1-3-4-5-6-10-18-14-13(15-19-16-14)12-8-7-9-17(2)11-12;3-1(4)2(5)6/h8H,3-7,9-11H2,1-2H3;(H,3,4)(H,5,6) |
| InChiKey: | InChIKey=ZJOUESNWCLASJP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.