* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GSK 650394 |
| CAS: | 890842-28-1 |
| English Synonyms: | GSK 650394 ; 2-CYCLOPENTYL-4-(5-PHENYL-1H-PYRROLO[2,3-B]PYRIDIN-3-YL)-BENZOIC ACID |
| MDL Number.: | MFCD12828779 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | c1ccc(cc1)c2cc3c(c[nH]c3nc2)c4ccc(c(c4)C5CCCC5)C(=O)O |
| InChi: | InChI=1S/C25H22N2O2/c28-25(29)20-11-10-18(12-21(20)17-8-4-5-9-17)23-15-27-24-22(23)13-19(14-26-24)16-6-2-1-3-7-16/h1-3,6-7,10-15,17H,4-5,8-9H2,(H,26,27)(H,28,29) |
| InChiKey: | InChIKey=WVSBGSNVCDAMCF-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.