* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-BROMO-N-PROPYL-2H,3H-NAPHTHO[2,3-B]FURAN-3-AMINE |
English Synonyms: | 9-BROMO-N-PROPYL-2H,3H-NAPHTHO[2,3-B]FURAN-3-AMINE |
MDL Number.: | MFCD12862749 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCCNC1COc2c1cc3ccccc3c2Br |
InChi: | InChI=1S/C15H16BrNO/c1-2-7-17-13-9-18-15-12(13)8-10-5-3-4-6-11(10)14(15)16/h3-6,8,13,17H,2,7,9H2,1H3 |
InChiKey: | InChIKey=HWWFOEZUBIIDEV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.