* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PHENYL(2H-1,2,3,4-TETRAZOL-5-YL)METHANAMINE |
English Synonyms: | PHENYL(2H-1,2,3,4-TETRAZOL-5-YL)METHANAMINE |
MDL Number.: | MFCD12912751 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)C(c2n[nH]nn2)N |
InChi: | InChI=1S/C8H9N5/c9-7(8-10-12-13-11-8)6-4-2-1-3-5-6/h1-5,7H,9H2,(H,10,11,12,13) |
InChiKey: | InChIKey=BVBOWMSUTQPATP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.