* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PD 166866 |
| CAS: | 192705-79-6 |
| English Synonyms: | 1-[2-AMINO-6-(3,5-DIMETHOXYPHENYL)-PYRIDO[2,3-D]PYRIMIDIN-7-YL]-3-TERT-BUTYL UREA ; PD 166866 |
| MDL Number.: | MFCD12922514 |
| H bond acceptor: | 9 |
| H bond donor: | 3 |
| Smile: | CC(C)(C)NC(=O)Nc1c(cc2cnc(nc2n1)N)c3cc(cc(c3)OC)OC |
| InChi: | InChI=1S/C20H24N6O3/c1-20(2,3)26-19(27)25-17-15(8-12-10-22-18(21)24-16(12)23-17)11-6-13(28-4)9-14(7-11)29-5/h6-10H,1-5H3,(H4,21,22,23,24,25,26,27) |
| InChiKey: | InChIKey=NHJSWORVNIOXIT-UHFFFAOYSA-N |
|
|
|
|
| Symbol: |
GHS07
|
| Signal word: | Warning |
| Hazard statements: | H302 |
| hazard symbol: | Xn |
| Risk Code: | R:22 |
| WGK Germany: | 1 |
* If the product has intellectual property rights, a license granted is must or contact us.