* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1,2-DIHYDRO-5-METHYL-3H-PYRROL-3-ONE |
| CAS: | 68332-41-2 |
| English Synonyms: | 1,2-DIHYDRO-5-METHYL-3H-PYRROL-3-ONE |
| MDL Number.: | MFCD12923460 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CC1=CC(=O)CN1 |
| InChi: | InChI=1S/C5H7NO/c1-4-2-5(7)3-6-4/h2,6H,3H2,1H3 |
| InChiKey: | InChIKey=LTYOGNRMBPRXKZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.