* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PYRROLO[1,2-A]PYRIMIDIN-6(2H)-ONE |
CAS: | 91666-94-3 |
English Synonyms: | PYRROLO[1,2-A]PYRIMIDIN-6(2H)-ONE |
MDL Number.: | MFCD12923661 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | C1C=CN2C(=N1)C=CC2=O |
InChi: | InChI=1S/C7H6N2O/c10-7-3-2-6-8-4-1-5-9(6)7/h1-3,5H,4H2 |
InChiKey: | InChIKey=ZEAQMYZKXKMBKD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.