* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PYRROLO[1,2-C]PYRIMIDINE |
CAS: | 274-43-1 |
English Synonyms: | PYRROLO[1,2-C]PYRIMIDINE |
MDL Number.: | MFCD12923857 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1cc2ccncn2c1 |
InChi: | InChI=1S/C7H6N2/c1-2-7-3-4-8-6-9(7)5-1/h1-6H |
InChiKey: | InChIKey=RIEKLTCRUGDAPM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.